C24H20Cl2N4 — CID 2483919
(2R)-10,12-dichloro-4-methyl-6-(2-methylphenyl)-2-(4-methylphenyl)-1,5,6,8-tetrazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene (PubChem CID 2483919) has the molecular formula C24H20Cl2N4 and a molecular weight of 435.36 g/mol. Its IUPAC name is (2R)-10,12-dichloro-4-methyl-6-(2-methylphenyl)-2-(4-methylphenyl)-1,5,6,8-tetrazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene.
| Compound Name | (2R)-10,12-dichloro-4-methyl-6-(2-methylphenyl)-2-(4-methylphenyl)-1,5,6,8-tetrazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene |
|---|---|
| PubChem CID | 2483919 |
| Molecular Formula | C24H20Cl2N4 |
| Molecular Weight | 435.36 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | (2R)-10,12-dichloro-4-methyl-6-(2-methylphenyl)-2-(4-methylphenyl)-1,5,6,8-tetrazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene |
| SMILES | Cc1ccc([C@@H]2c3c(C)nn(-c4ccccc4C)c3N=C3C(Cl)=CC(Cl)=CN32)cc1 |
| InChI | InChI=1S/C24H20Cl2N4/c1-14-8-10-17(11-9-14)22-21-16(3)28-30(20-7-5-4-6-15(20)2)24(21)27-23-19(26)12-18(25)13-29(22)23/h4-13,22H,1-3H3/t22-/m1/s1 |
| InChIKey | YEMNVAYACSCOFR-JOCHJYFZSA-N |
| XLogP | 6.45 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.36 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |