C24H18Cl2N4O — CID 2405574
2-[(2R)-10,12-dichloro-4-methyl-6-(4-methylphenyl)-1,5,6,8-tetrazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaen-2-yl]benzaldehyde (PubChem CID 2405574) has the molecular formula C24H18Cl2N4O and a molecular weight of 449.34 g/mol. Its IUPAC name is 2-[(2R)-10,12-dichloro-4-methyl-6-(4-methylphenyl)-1,5,6,8-tetrazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaen-2-yl]benzaldehyde.
| Compound Name | 2-[(2R)-10,12-dichloro-4-methyl-6-(4-methylphenyl)-1,5,6,8-tetrazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaen-2-yl]benzaldehyde |
|---|---|
| PubChem CID | 2405574 |
| Molecular Formula | C24H18Cl2N4O |
| Molecular Weight | 449.34 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | 2-[(2R)-10,12-dichloro-4-methyl-6-(4-methylphenyl)-1,5,6,8-tetrazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaen-2-yl]benzaldehyde |
| SMILES | Cc1ccc(-n2nc(C)c3c2N=C2C(Cl)=CC(Cl)=CN2[C@@H]3c2ccccc2C=O)cc1 |
| InChI | InChI=1S/C24H18Cl2N4O/c1-14-7-9-18(10-8-14)30-24-21(15(2)28-30)22(19-6-4-3-5-16(19)13-31)29-12-17(25)11-20(26)23(29)27-24/h3-13,22H,1-2H3/t22-/m1/s1 |
| InChIKey | MBNYTADRMBGCHF-JOCHJYFZSA-N |
| XLogP | 5.95 |
| TPSA | 50.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.34 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|