C14H15Cl2N3O3S — CID 5028574
2-[2-(3,5-dichloro-4-hydroxyphenyl)imino-3-ethyl-4-oxo-1,3-thiazolidin-5-yl]-N-methylacetamide (PubChem CID 5028574) has the molecular formula C14H15Cl2N3O3S and a molecular weight of 376.27 g/mol. Its IUPAC name is 2-[2-(3,5-dichloro-4-hydroxyphenyl)imino-3-ethyl-4-oxo-1,3-thiazolidin-5-yl]-N-methylacetamide.
| Compound Name | 2-[2-(3,5-dichloro-4-hydroxyphenyl)imino-3-ethyl-4-oxo-1,3-thiazolidin-5-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 5028574 |
| Molecular Formula | C14H15Cl2N3O3S |
| Molecular Weight | 376.27 g/mol |
| Exact Mass | 375.02 |
| IUPAC Name | 2-[2-(3,5-dichloro-4-hydroxyphenyl)imino-3-ethyl-4-oxo-1,3-thiazolidin-5-yl]-N-methylacetamide |
| SMILES | CCN1C(=O)C(CC(=O)NC)S/C1=N\c1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C14H15Cl2N3O3S/c1-3-19-13(22)10(6-11(20)17-2)23-14(19)18-7-4-8(15)12(21)9(16)5-7/h4-5,10,21H,3,6H2,1-2H3,(H,17,20)/b18-14- |
| InChIKey | DYNASWLPERPIEJ-JXAWBTAJSA-N |
| XLogP | 2.79 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.27 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|