C14H18N3O2+ — CID 5043626
[2-(furan-2-carbonylamino)-1-pyridin-3-ylethyl]-dimethylazanium (PubChem CID 5043626) has the molecular formula C14H18N3O2+ and a molecular weight of 260.32 g/mol. Its IUPAC name is [2-(furan-2-carbonylamino)-1-pyridin-3-ylethyl]-dimethylazanium.
| Compound Name | [2-(furan-2-carbonylamino)-1-pyridin-3-ylethyl]-dimethylazanium |
|---|---|
| PubChem CID | 5043626 |
| Molecular Formula | C14H18N3O2+ |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | [2-(furan-2-carbonylamino)-1-pyridin-3-ylethyl]-dimethylazanium |
| SMILES | C[NH+](C)C(CNC(=O)c1ccco1)c1cccnc1 |
| InChI | InChI=1S/C14H17N3O2/c1-17(2)12(11-5-3-7-15-9-11)10-16-14(18)13-6-4-8-19-13/h3-9,12H,10H2,1-2H3,(H,16,18)/p+1 |
| InChIKey | TVFHAFZJAZJZFW-UHFFFAOYSA-O |
| XLogP | 0.29 |
| TPSA | 59.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |