C14H17N3OS — CID 5053720
2-cyano-3-ethylsulfanyl-3-(4,5,6,7-tetrahydro-1H-indol-2-yl)prop-2-enamide (PubChem CID 5053720) has the molecular formula C14H17N3OS and a molecular weight of 275.38 g/mol. Its IUPAC name is 2-cyano-3-ethylsulfanyl-3-(4,5,6,7-tetrahydro-1H-indol-2-yl)prop-2-enamide.
| Compound Name | 2-cyano-3-ethylsulfanyl-3-(4,5,6,7-tetrahydro-1H-indol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 5053720 |
| Molecular Formula | C14H17N3OS |
| Molecular Weight | 275.38 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 2-cyano-3-ethylsulfanyl-3-(4,5,6,7-tetrahydro-1H-indol-2-yl)prop-2-enamide |
| SMILES | CCSC(=C(C#N)C(N)=O)c1cc2c([nH]1)CCCC2 |
| InChI | InChI=1S/C14H17N3OS/c1-2-19-13(10(8-15)14(16)18)12-7-9-5-3-4-6-11(9)17-12/h7,17H,2-6H2,1H3,(H2,16,18) |
| InChIKey | HFVGDMSRDONYSL-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 82.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.38 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|