C25H27Cl2NO6 — CID 505633
3-[(3,4-dichlorophenyl)methyl-[3,4-dioxo-4-(2,3,3-trimethylbutan-2-yloxy)butanoyl]amino]benzoic acid (PubChem CID 505633) has the molecular formula C25H27Cl2NO6 and a molecular weight of 508.40 g/mol. Its IUPAC name is 3-[(3,4-dichlorophenyl)methyl-[3,4-dioxo-4-(2,3,3-trimethylbutan-2-yloxy)butanoyl]amino]benzoic acid.
| Compound Name | 3-[(3,4-dichlorophenyl)methyl-[3,4-dioxo-4-(2,3,3-trimethylbutan-2-yloxy)butanoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 505633 |
| Molecular Formula | C25H27Cl2NO6 |
| Molecular Weight | 508.40 g/mol |
| Exact Mass | 507.12 |
| IUPAC Name | 3-[(3,4-dichlorophenyl)methyl-[3,4-dioxo-4-(2,3,3-trimethylbutan-2-yloxy)butanoyl]amino]benzoic acid |
| SMILES | CC(C)(C)C(C)(C)OC(=O)C(=O)CC(=O)N(Cc1ccc(Cl)c(Cl)c1)c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C25H27Cl2NO6/c1-24(2,3)25(4,5)34-23(33)20(29)13-21(30)28(14-15-9-10-18(26)19(27)11-15)17-8-6-7-16(12-17)22(31)32/h6-12H,13-14H2,1-5H3,(H,31,32) |
| InChIKey | CJTQBHQACFXIIB-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.40 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|