C27H31Cl2N3O6 — CID 505644
2-methylbutan-2-yl 4-[3-acetamido-N-[(3,4-dichlorophenyl)methyl]-5-(dimethylcarbamoyl)anilino]-2,4-dioxobutanoate (PubChem CID 505644) has the molecular formula C27H31Cl2N3O6 and a molecular weight of 564.47 g/mol. Its IUPAC name is 2-methylbutan-2-yl 4-[3-acetamido-N-[(3,4-dichlorophenyl)methyl]-5-(dimethylcarbamoyl)anilino]-2,4-dioxobutanoate.
| Compound Name | 2-methylbutan-2-yl 4-[3-acetamido-N-[(3,4-dichlorophenyl)methyl]-5-(dimethylcarbamoyl)anilino]-2,4-dioxobutanoate |
|---|---|
| PubChem CID | 505644 |
| Molecular Formula | C27H31Cl2N3O6 |
| Molecular Weight | 564.47 g/mol |
| Exact Mass | 563.16 |
| IUPAC Name | 2-methylbutan-2-yl 4-[3-acetamido-N-[(3,4-dichlorophenyl)methyl]-5-(dimethylcarbamoyl)anilino]-2,4-dioxobutanoate |
| SMILES | CCC(C)(C)OC(=O)C(=O)CC(=O)N(Cc1ccc(Cl)c(Cl)c1)c1cc(NC(C)=O)cc(C(=O)N(C)C)c1 |
| InChI | InChI=1S/C27H31Cl2N3O6/c1-7-27(3,4)38-26(37)23(34)14-24(35)32(15-17-8-9-21(28)22(29)10-17)20-12-18(25(36)31(5)6)11-19(13-20)30-16(2)33/h8-13H,7,14-15H2,1-6H3,(H,30,33) |
| InChIKey | LCISFPGQCQZIQS-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.47 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|