C23H18N6O2S — CID 50754048
N-(1,3-benzothiazol-2-yl)-2-(2-oxo-11-phenyl-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl)acetamide (PubChem CID 50754048) has the molecular formula C23H18N6O2S and a molecular weight of 442.50 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-2-(2-oxo-11-phenyl-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl)acetamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-2-(2-oxo-11-phenyl-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl)acetamide |
|---|---|
| PubChem CID | 50754048 |
| Molecular Formula | C23H18N6O2S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-2-(2-oxo-11-phenyl-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl)acetamide |
| SMILES | O=C(Cn1c2c(c(=O)n3nc(-c4ccccc4)nc13)CCC2)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C23H18N6O2S/c30-19(25-22-24-16-10-4-5-12-18(16)32-22)13-28-17-11-6-9-15(17)21(31)29-23(28)26-20(27-29)14-7-2-1-3-8-14/h1-5,7-8,10,12H,6,9,11,13H2,(H,24,25,30) |
| InChIKey | XCDKBFLMTXCDDK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 94.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |