C24H28N4O3 — CID 50765227
propyl 6,7-dimethyl-3-(4-morpholin-4-ylanilino)quinoxaline-2-carboxylate (PubChem CID 50765227) has the molecular formula C24H28N4O3 and a molecular weight of 420.51 g/mol. Its IUPAC name is propyl 6,7-dimethyl-3-(4-morpholin-4-ylanilino)quinoxaline-2-carboxylate.
| Compound Name | propyl 6,7-dimethyl-3-(4-morpholin-4-ylanilino)quinoxaline-2-carboxylate |
|---|---|
| PubChem CID | 50765227 |
| Molecular Formula | C24H28N4O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | propyl 6,7-dimethyl-3-(4-morpholin-4-ylanilino)quinoxaline-2-carboxylate |
| SMILES | CCCOC(=O)c1nc2cc(C)c(C)cc2nc1Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C24H28N4O3/c1-4-11-31-24(29)22-23(27-21-15-17(3)16(2)14-20(21)26-22)25-18-5-7-19(8-6-18)28-9-12-30-13-10-28/h5-8,14-15H,4,9-13H2,1-3H3,(H,25,27) |
| InChIKey | JSQOHZZLZOTHRY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|