C25H25ClN4O3S — CID 50822824
N-[2-chloro-4-[[2-[2-(1-ethylbenzimidazol-2-yl)ethyl]phenyl]sulfamoyl]phenyl]acetamide (PubChem CID 50822824) has the molecular formula C25H25ClN4O3S and a molecular weight of 497.02 g/mol. Its IUPAC name is N-[2-chloro-4-[[2-[2-(1-ethylbenzimidazol-2-yl)ethyl]phenyl]sulfamoyl]phenyl]acetamide.
| Compound Name | N-[2-chloro-4-[[2-[2-(1-ethylbenzimidazol-2-yl)ethyl]phenyl]sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 50822824 |
| Molecular Formula | C25H25ClN4O3S |
| Molecular Weight | 497.02 g/mol |
| Exact Mass | 496.13 |
| IUPAC Name | N-[2-chloro-4-[[2-[2-(1-ethylbenzimidazol-2-yl)ethyl]phenyl]sulfamoyl]phenyl]acetamide |
| SMILES | CCn1c(CCc2ccccc2NS(=O)(=O)c2ccc(NC(C)=O)c(Cl)c2)nc2ccccc21 |
| InChI | InChI=1S/C25H25ClN4O3S/c1-3-30-24-11-7-6-10-23(24)28-25(30)15-12-18-8-4-5-9-21(18)29-34(32,33)19-13-14-22(20(26)16-19)27-17(2)31/h4-11,13-14,16,29H,3,12,15H2,1-2H3,(H,27,31) |
| InChIKey | YRIVGOUNVHWDNQ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.02 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |