C22H31N5O4S — CID 50837043
N-[3-(3-methylpiperidin-1-yl)propyl]-5-(4-pyrrolidin-1-ylsulfonylphenyl)-1,3,4-oxadiazole-2-carboxamide (PubChem CID 50837043) has the molecular formula C22H31N5O4S and a molecular weight of 461.59 g/mol. Its IUPAC name is N-[3-(3-methylpiperidin-1-yl)propyl]-5-(4-pyrrolidin-1-ylsulfonylphenyl)-1,3,4-oxadiazole-2-carboxamide.
| Compound Name | N-[3-(3-methylpiperidin-1-yl)propyl]-5-(4-pyrrolidin-1-ylsulfonylphenyl)-1,3,4-oxadiazole-2-carboxamide |
|---|---|
| PubChem CID | 50837043 |
| Molecular Formula | C22H31N5O4S |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | N-[3-(3-methylpiperidin-1-yl)propyl]-5-(4-pyrrolidin-1-ylsulfonylphenyl)-1,3,4-oxadiazole-2-carboxamide |
| SMILES | CC1CCCN(CCCNC(=O)c2nnc(-c3ccc(S(=O)(=O)N4CCCC4)cc3)o2)C1 |
| InChI | InChI=1S/C22H31N5O4S/c1-17-6-4-12-26(16-17)13-5-11-23-20(28)22-25-24-21(31-22)18-7-9-19(10-8-18)32(29,30)27-14-2-3-15-27/h7-10,17H,2-6,11-16H2,1H3,(H,23,28) |
| InChIKey | KYIMCXGZZBGHJV-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|