C12H11BrF3N3S — CID 50882473
6-bromo-N-[(Z)-butan-2-ylideneamino]-4-(trifluoromethyl)-1,3-benzothiazol-2-amine (PubChem CID 50882473) has the molecular formula C12H11BrF3N3S and a molecular weight of 366.21 g/mol. Its IUPAC name is 6-bromo-N-[(Z)-butan-2-ylideneamino]-4-(trifluoromethyl)-1,3-benzothiazol-2-amine.
| Compound Name | 6-bromo-N-[(Z)-butan-2-ylideneamino]-4-(trifluoromethyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 50882473 |
| Molecular Formula | C12H11BrF3N3S |
| Molecular Weight | 366.21 g/mol |
| Exact Mass | 364.98 |
| IUPAC Name | 6-bromo-N-[(Z)-butan-2-ylideneamino]-4-(trifluoromethyl)-1,3-benzothiazol-2-amine |
| SMILES | CC/C(C)=N\Nc1nc2c(C(F)(F)F)cc(Br)cc2s1 |
| InChI | InChI=1S/C12H11BrF3N3S/c1-3-6(2)18-19-11-17-10-8(12(14,15)16)4-7(13)5-9(10)20-11/h4-5H,3H2,1-2H3,(H,17,19)/b18-6- |
| InChIKey | ZIFPQDMXHNVKGM-FXBPXSCXSA-N |
| XLogP | 5.28 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.21 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|