About bis((4-chlorophenyl)-chromen-2-ylideneazanium);nickel
bis((4-chlorophenyl)-chromen-2-ylideneazanium);nickel (PubChem CID 50896907) has the molecular formula C30H22Cl2N2NiO2+2
and a molecular weight of 572.12 g/mol. Its IUPAC name is bis((4-chlorophenyl)-chromen-2-ylideneazanium);nickel.
Molecular Properties
| Compound Name | bis((4-chlorophenyl)-chromen-2-ylideneazanium);nickel |
| PubChem CID | 50896907 |
| Molecular Formula | C30H22Cl2N2NiO2+2 |
| Molecular Weight | 572.12 g/mol |
| Exact Mass | 570.04 |
| IUPAC Name | bis((4-chlorophenyl)-chromen-2-ylideneazanium);nickel |
| SMILES | Clc1ccc(/[NH+]=c2\ccc3ccccc3o2)cc1.Clc1ccc(/[NH+]=c2\ccc3ccccc3o2)cc1.[Ni] |
| InChI | InChI=1S/2C15H10ClNO.Ni/c2*16-12-6-8-13(9-7-12)17-15-10-5-11-3-1-2-4-14(11)18-15;/h2*1-10H;/p+2/b2*17-15+; |
| InChIKey | IGDXKZANUDLSOW-RVUOTHGYSA-P |
| XLogP | 4.80 |
| TPSA | 54.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 572.12 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze bis((4-chlorophenyl)-chromen-2-ylideneazanium);nickel with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((4-chlorophenyl)-chromen-2-ylideneazanium);nickel?
The IUPAC name of bis((4-chlorophenyl)-chromen-2-ylideneazanium);nickel (CID 50896907) is bis((4-chlorophenyl)-chromen-2-ylideneazanium);nickel.
What is the SMILES notation for bis((4-chlorophenyl)-chromen-2-ylideneazanium);nickel?
The canonical SMILES for bis((4-chlorophenyl)-chromen-2-ylideneazanium);nickel is Clc1ccc(/[NH+]=c2\ccc3ccccc3o2)cc1.Clc1ccc(/[NH+]=c2\ccc3ccccc3o2)cc1.[Ni].
What is the InChIKey of bis((4-chlorophenyl)-chromen-2-ylideneazanium);nickel?
The InChIKey is IGDXKZANUDLSOW-RVUOTHGYSA-P. The full InChI is InChI=1S/2C15H10ClNO.Ni/c2*16-12-6-8-13(9-7-12)17-15-10-5-11-3-1-2-4-14(11)18-15;/h2*1-10H;/p+2/b2*17-15+;.
What are the key properties of bis((4-chlorophenyl)-chromen-2-ylideneazanium);nickel?
bis((4-chlorophenyl)-chromen-2-ylideneazanium);nickel has a molecular weight of 572.12 g/mol, XLogP of 4.80, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis((4-chlorophenyl)-chromen-2-ylideneazanium);nickel is sourced from PubChem (CID 50896907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).