C25H31N3O4 — CID 50898250
ethyl 1-[2-methyl-2-[(4-phenylphenyl)carbamoylamino]propanoyl]piperidine-4-carboxylate (PubChem CID 50898250) has the molecular formula C25H31N3O4 and a molecular weight of 437.54 g/mol. Its IUPAC name is ethyl 1-[2-methyl-2-[(4-phenylphenyl)carbamoylamino]propanoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-methyl-2-[(4-phenylphenyl)carbamoylamino]propanoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 50898250 |
| Molecular Formula | C25H31N3O4 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | ethyl 1-[2-methyl-2-[(4-phenylphenyl)carbamoylamino]propanoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)C(C)(C)NC(=O)Nc2ccc(-c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C25H31N3O4/c1-4-32-22(29)20-14-16-28(17-15-20)23(30)25(2,3)27-24(31)26-21-12-10-19(11-13-21)18-8-6-5-7-9-18/h5-13,20H,4,14-17H2,1-3H3,(H2,26,27,31) |
| InChIKey | YYUHOHHASVSAHQ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |