C18H17N3O4S — CID 50901736
methyl 3-ethyl-6-(2-hydroxybenzoyl)-1-methyl-2-sulfanylideneimidazo[4,5-b]pyridine-5-carboxylate (PubChem CID 50901736) has the molecular formula C18H17N3O4S and a molecular weight of 371.42 g/mol. Its IUPAC name is methyl 3-ethyl-6-(2-hydroxybenzoyl)-1-methyl-2-sulfanylideneimidazo[4,5-b]pyridine-5-carboxylate.
| Compound Name | methyl 3-ethyl-6-(2-hydroxybenzoyl)-1-methyl-2-sulfanylideneimidazo[4,5-b]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 50901736 |
| Molecular Formula | C18H17N3O4S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | methyl 3-ethyl-6-(2-hydroxybenzoyl)-1-methyl-2-sulfanylideneimidazo[4,5-b]pyridine-5-carboxylate |
| SMILES | CCn1c(=S)n(C)c2cc(C(=O)c3ccccc3O)c(C(=O)OC)nc21 |
| InChI | InChI=1S/C18H17N3O4S/c1-4-21-16-12(20(2)18(21)26)9-11(14(19-16)17(24)25-3)15(23)10-7-5-6-8-13(10)22/h5-9,22H,4H2,1-3H3 |
| InChIKey | SKGAYSVUFHFUAJ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|