C14H18O3 — CID 50902748
(E)-1,2,3,5,5,5-hexadeuterio-1-(4,6,7-trideuterio-1,3-benzodioxol-5-yl)-4,4-bis(trideuteriomethyl)pent-1-en-3-ol (PubChem CID 50902748) has the molecular formula C14H18O3 and a molecular weight of 249.39 g/mol. Its IUPAC name is (E)-1,2,3,5,5,5-hexadeuterio-1-(4,6,7-trideuterio-1,3-benzodioxol-5-yl)-4,4-bis(trideuteriomethyl)pent-1-en-3-ol.
| Compound Name | (E)-1,2,3,5,5,5-hexadeuterio-1-(4,6,7-trideuterio-1,3-benzodioxol-5-yl)-4,4-bis(trideuteriomethyl)pent-1-en-3-ol |
|---|---|
| PubChem CID | 50902748 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 249.39 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | (E)-1,2,3,5,5,5-hexadeuterio-1-(4,6,7-trideuterio-1,3-benzodioxol-5-yl)-4,4-bis(trideuteriomethyl)pent-1-en-3-ol |
| SMILES | [2H]/C(=C(/[2H])C([2H])(O)C(C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])c1c([2H])c([2H])c2c(c1[2H])OCO2 |
| InChI | InChI=1S/C14H18O3/c1-14(2,3)13(15)7-5-10-4-6-11-12(8-10)17-9-16-11/h4-8,13,15H,9H2,1-3H3/b7-5+/i1D3,2D3,3D3,4D,5D,6D,7D,8D,13D |
| InChIKey | IBLNKMRFIPWSOY-PIACHNHUSA-N |
| XLogP | 2.84 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.39 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |