C26H23N3O3S — CID 5091298
N-[3-hydroxy-1-oxo-1-(1,3-thiazol-2-ylamino)propan-2-yl]-4-pyren-1-ylbutanamide (PubChem CID 5091298) has the molecular formula C26H23N3O3S and a molecular weight of 457.56 g/mol. Its IUPAC name is N-[3-hydroxy-1-oxo-1-(1,3-thiazol-2-ylamino)propan-2-yl]-4-pyren-1-ylbutanamide.
| Compound Name | N-[3-hydroxy-1-oxo-1-(1,3-thiazol-2-ylamino)propan-2-yl]-4-pyren-1-ylbutanamide |
|---|---|
| PubChem CID | 5091298 |
| Molecular Formula | C26H23N3O3S |
| Molecular Weight | 457.56 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | N-[3-hydroxy-1-oxo-1-(1,3-thiazol-2-ylamino)propan-2-yl]-4-pyren-1-ylbutanamide |
| SMILES | O=C(CCCc1ccc2ccc3cccc4ccc1c2c34)NC(CO)C(=O)Nc1nccs1 |
| InChI | InChI=1S/C26H23N3O3S/c30-15-21(25(32)29-26-27-13-14-33-26)28-22(31)6-2-3-16-7-8-19-10-9-17-4-1-5-18-11-12-20(16)24(19)23(17)18/h1,4-5,7-14,21,30H,2-3,6,15H2,(H,28,31)(H,27,29,32) |
| InChIKey | NCMJAJOYWMOPMN-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.56 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|