C18H22NO4+ — CID 50915784
(4S,4aS,12bR)-4a,11-dihydroxy-3,3-dimethyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one (PubChem CID 50915784) has the molecular formula C18H22NO4+ and a molecular weight of 316.38 g/mol. Its IUPAC name is (4S,4aS,12bR)-4a,11-dihydroxy-3,3-dimethyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one.
| Compound Name | (4S,4aS,12bR)-4a,11-dihydroxy-3,3-dimethyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one |
|---|---|
| PubChem CID | 50915784 |
| Molecular Formula | C18H22NO4+ |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | (4S,4aS,12bR)-4a,11-dihydroxy-3,3-dimethyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one |
| SMILES | C[N+]1(C)CC[C@]23c4c5ccc(O)c4C[C@H]1[C@]2(O)CCC(=O)C3O5 |
| InChI | InChI=1S/C18H21NO4/c1-19(2)8-7-17-15-10-9-14(19)18(17,22)6-5-12(21)16(17)23-13(15)4-3-11(10)20/h3-4,14,16,22H,5-9H2,1-2H3/p+1/t14-,16?,17+,18+/m0/s1 |
| InChIKey | YYAUSLPDTYVFCD-KEJKVHCVSA-O |
| XLogP | 0.89 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|