C33H20F12O2 — CID 50917368
5,5'-bis[3,5-bis(trifluoromethyl)phenyl]-3,3'-spirobi[1,2-dihydroindene]-4,4'-diol (PubChem CID 50917368) has the molecular formula C33H20F12O2 and a molecular weight of 676.50 g/mol. Its IUPAC name is 5,5'-bis[3,5-bis(trifluoromethyl)phenyl]-3,3'-spirobi[1,2-dihydroindene]-4,4'-diol.
| Compound Name | 5,5'-bis[3,5-bis(trifluoromethyl)phenyl]-3,3'-spirobi[1,2-dihydroindene]-4,4'-diol |
|---|---|
| PubChem CID | 50917368 |
| Molecular Formula | C33H20F12O2 |
| Molecular Weight | 676.50 g/mol |
| Exact Mass | 676.13 |
| IUPAC Name | 5,5'-bis[3,5-bis(trifluoromethyl)phenyl]-3,3'-spirobi[1,2-dihydroindene]-4,4'-diol |
| SMILES | Oc1c(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)ccc2c1C1(CC2)CCc2ccc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)c(O)c21 |
| InChI | InChI=1S/C33H20F12O2/c34-30(35,36)19-9-17(10-20(13-19)31(37,38)39)23-3-1-15-5-7-29(25(15)27(23)46)8-6-16-2-4-24(28(47)26(16)29)18-11-21(32(40,41)42)14-22(12-18)33(43,44)45/h1-4,9-14,46-47H,5-8H2 |
| InChIKey | FTEQZGBBSPOTTH-UHFFFAOYSA-N |
| XLogP | 10.69 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.50 |
| LogP ≤ 5 | 10.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |