C18H17FN2O3S2 — CID 50928494
7-fluoro-5,5-dioxo-N-(2-thiophen-2-ylethyl)-2,3-dihydro-1H-pyrrolo[2,1-c][1,4]benzothiazine-4-carboxamide (PubChem CID 50928494) has the molecular formula C18H17FN2O3S2 and a molecular weight of 392.48 g/mol. Its IUPAC name is 7-fluoro-5,5-dioxo-N-(2-thiophen-2-ylethyl)-2,3-dihydro-1H-pyrrolo[2,1-c][1,4]benzothiazine-4-carboxamide.
| Compound Name | 7-fluoro-5,5-dioxo-N-(2-thiophen-2-ylethyl)-2,3-dihydro-1H-pyrrolo[2,1-c][1,4]benzothiazine-4-carboxamide |
|---|---|
| PubChem CID | 50928494 |
| Molecular Formula | C18H17FN2O3S2 |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | 7-fluoro-5,5-dioxo-N-(2-thiophen-2-ylethyl)-2,3-dihydro-1H-pyrrolo[2,1-c][1,4]benzothiazine-4-carboxamide |
| SMILES | O=C(NCCc1cccs1)C1=C2CCCN2c2ccc(F)cc2S1(=O)=O |
| InChI | InChI=1S/C18H17FN2O3S2/c19-12-5-6-14-16(11-12)26(23,24)17(15-4-1-9-21(14)15)18(22)20-8-7-13-3-2-10-25-13/h2-3,5-6,10-11H,1,4,7-9H2,(H,20,22) |
| InChIKey | SGZGHCCIDQULFQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_66_one(8)', 'substructure': 'N/A'} |
|---|