C13H10ClNOS — CID 50988845
2-(4-chlorophenyl)-5,6-dihydro-4H-1,3-benzothiazol-7-one (PubChem CID 50988845) has the molecular formula C13H10ClNOS and a molecular weight of 263.75 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-5,6-dihydro-4H-1,3-benzothiazol-7-one.
| Compound Name | 2-(4-chlorophenyl)-5,6-dihydro-4H-1,3-benzothiazol-7-one |
|---|---|
| PubChem CID | 50988845 |
| Molecular Formula | C13H10ClNOS |
| Molecular Weight | 263.75 g/mol |
| Exact Mass | 263.02 |
| IUPAC Name | 2-(4-chlorophenyl)-5,6-dihydro-4H-1,3-benzothiazol-7-one |
| SMILES | O=C1CCCc2nc(-c3ccc(Cl)cc3)sc21 |
| InChI | InChI=1S/C13H10ClNOS/c14-9-6-4-8(5-7-9)13-15-10-2-1-3-11(16)12(10)17-13/h4-7H,1-3H2 |
| InChIKey | XXCCTQYLMPIBBY-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.75 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |