C26H23Cl2N3O4 — CID 50988924
N-[(E)-[4-[bis(2-chloroethyl)amino]phenyl]methylideneamino]-2-(9-oxoxanthen-3-yl)oxyacetamide (PubChem CID 50988924) has the molecular formula C26H23Cl2N3O4 and a molecular weight of 512.39 g/mol. Its IUPAC name is N-[(E)-[4-[bis(2-chloroethyl)amino]phenyl]methylideneamino]-2-(9-oxoxanthen-3-yl)oxyacetamide.
| Compound Name | N-[(E)-[4-[bis(2-chloroethyl)amino]phenyl]methylideneamino]-2-(9-oxoxanthen-3-yl)oxyacetamide |
|---|---|
| PubChem CID | 50988924 |
| Molecular Formula | C26H23Cl2N3O4 |
| Molecular Weight | 512.39 g/mol |
| Exact Mass | 511.11 |
| IUPAC Name | N-[(E)-[4-[bis(2-chloroethyl)amino]phenyl]methylideneamino]-2-(9-oxoxanthen-3-yl)oxyacetamide |
| SMILES | O=C(COc1ccc2c(=O)c3ccccc3oc2c1)N/N=C/c1ccc(N(CCCl)CCCl)cc1 |
| InChI | InChI=1S/C26H23Cl2N3O4/c27-11-13-31(14-12-28)19-7-5-18(6-8-19)16-29-30-25(32)17-34-20-9-10-22-24(15-20)35-23-4-2-1-3-21(23)26(22)33/h1-10,15-16H,11-14,17H2,(H,30,32)/b29-16+ |
| InChIKey | NYHONCZXWSEFDJ-MUFRIFMGSA-N |
| XLogP | 4.76 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.39 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|