About trans-(1R,2S)-2-aminocyclopentane-1-carbonitrile
trans-(1R,2S)-2-aminocyclopentane-1-carbonitrile (PubChem CID 50989537) has the molecular formula C6H10N2
and a molecular weight of 110.16 g/mol. Its IUPAC name is trans-(1R,2S)-2-aminocyclopentane-1-carbonitrile.
Analyze trans-(1R,2S)-2-aminocyclopentane-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,2S)-2-aminocyclopentane-1-carbonitrile?
The IUPAC name of trans-(1R,2S)-2-aminocyclopentane-1-carbonitrile (CID 50989537) is trans-(1R,2S)-2-aminocyclopentane-1-carbonitrile.
What is the SMILES notation for trans-(1R,2S)-2-aminocyclopentane-1-carbonitrile?
The canonical SMILES for trans-(1R,2S)-2-aminocyclopentane-1-carbonitrile is N#C[C@@H]1CCC[C@@H]1N.
What is the InChIKey of trans-(1R,2S)-2-aminocyclopentane-1-carbonitrile?
The InChIKey is HERJCJRIDHRCKG-WDSKDSINSA-N. The full InChI is InChI=1S/C6H10N2/c7-4-5-2-1-3-6(5)8/h5-6H,1-3,8H2/t5-,6-/m0/s1.
What are the key properties of trans-(1R,2S)-2-aminocyclopentane-1-carbonitrile?
trans-(1R,2S)-2-aminocyclopentane-1-carbonitrile has a molecular weight of 110.16 g/mol, XLogP of 0.64, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2S)-2-aminocyclopentane-1-carbonitrile is sourced from PubChem (CID 50989537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).