C11H14IN2O4PS — CID 50993144
4-(5-diethoxyphosphorylfuran-2-yl)-5-iodo-1,3-thiazol-2-amine (PubChem CID 50993144) has the molecular formula C11H14IN2O4PS and a molecular weight of 428.19 g/mol. Its IUPAC name is 4-(5-diethoxyphosphorylfuran-2-yl)-5-iodo-1,3-thiazol-2-amine.
| Compound Name | 4-(5-diethoxyphosphorylfuran-2-yl)-5-iodo-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 50993144 |
| Molecular Formula | C11H14IN2O4PS |
| Molecular Weight | 428.19 g/mol |
| Exact Mass | 427.95 |
| IUPAC Name | 4-(5-diethoxyphosphorylfuran-2-yl)-5-iodo-1,3-thiazol-2-amine |
| SMILES | CCOP(=O)(OCC)c1ccc(-c2nc(N)sc2I)o1 |
| InChI | InChI=1S/C11H14IN2O4PS/c1-3-16-19(15,17-4-2)8-6-5-7(18-8)9-10(12)20-11(13)14-9/h5-6H,3-4H2,1-2H3,(H2,13,14) |
| InChIKey | VJRTWQIIBURAFA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.19 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|