C26H49N3OS3 — CID 50994993
5-(5-ethenyl-2-hydroxycyclohexyl)sulfanyl-1,3,4-thiadiazole-2-thiolate;tetrabutylazanium (PubChem CID 50994993) has the molecular formula C26H49N3OS3 and a molecular weight of 515.90 g/mol. Its IUPAC name is 5-(5-ethenyl-2-hydroxycyclohexyl)sulfanyl-1,3,4-thiadiazole-2-thiolate;tetrabutylazanium.
| Compound Name | 5-(5-ethenyl-2-hydroxycyclohexyl)sulfanyl-1,3,4-thiadiazole-2-thiolate;tetrabutylazanium |
|---|---|
| PubChem CID | 50994993 |
| Molecular Formula | C26H49N3OS3 |
| Molecular Weight | 515.90 g/mol |
| Exact Mass | 515.30 |
| IUPAC Name | 5-(5-ethenyl-2-hydroxycyclohexyl)sulfanyl-1,3,4-thiadiazole-2-thiolate;tetrabutylazanium |
| SMILES | C=CC1CCC(O)C(Sc2nnc([S-])s2)C1.CCCC[N+](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C16H36N.C10H14N2OS3/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-2-6-3-4-7(13)8(5-6)15-10-12-11-9(14)16-10/h5-16H2,1-4H3;2,6-8,13H,1,3-5H2,(H,11,14)/q+1;/p-1 |
| InChIKey | LZNHZUDITLSXMM-UHFFFAOYSA-M |
| XLogP | 7.26 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.90 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|