C18H25NO10 — CID 51033024
[(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-8-oxo-1-oxa-7-azaspiro[5.5]undecan-2-yl]methyl acetate (PubChem CID 51033024) has the molecular formula C18H25NO10 and a molecular weight of 415.40 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-8-oxo-1-oxa-7-azaspiro[5.5]undecan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-8-oxo-1-oxa-7-azaspiro[5.5]undecan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 51033024 |
| Molecular Formula | C18H25NO10 |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-8-oxo-1-oxa-7-azaspiro[5.5]undecan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@]2(CCCC(=O)N2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C18H25NO10/c1-9(20)25-8-13-15(26-10(2)21)16(27-11(3)22)17(28-12(4)23)18(29-13)7-5-6-14(24)19-18/h13,15-17H,5-8H2,1-4H3,(H,19,24)/t13-,15+,16+,17-,18+/m1/s1 |
| InChIKey | RXAIAHFSONMXCL-XNJHUCFUSA-N |
| XLogP | -0.26 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|