C9H10O4 — CID 51038740
2,2-dideuterio-2-(2,5,6-trideuterio-4-hydroxy-3-methoxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)acetic acid (PubChem CID 51038740) has the molecular formula C9H10O4 and a molecular weight of 193.16 g/mol. Its IUPAC name is 2,2-dideuterio-2-(2,5,6-trideuterio-4-hydroxy-3-methoxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)acetic acid.
| Compound Name | 2,2-dideuterio-2-(2,5,6-trideuterio-4-hydroxy-3-methoxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)acetic acid |
|---|---|
| PubChem CID | 51038740 |
| Molecular Formula | C9H10O4 |
| Molecular Weight | 193.16 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 2,2-dideuterio-2-(2,5,6-trideuterio-4-hydroxy-3-methoxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)acetic acid |
| SMILES | [2H][13c]1[13c]([2H])[13c](C([2H])([2H])C(=O)O)[13c]([2H])[13c](OC)[13c]1O |
| InChI | InChI=1S/C9H10O4/c1-13-8-4-6(5-9(11)12)2-3-7(8)10/h2-4,10H,5H2,1H3,(H,11,12)/i2+1D,3+1D,4+1D,5D2,6+1,7+1,8+1 |
| InChIKey | QRMZSPFSDQBLIX-GDYPLZOASA-N |
| XLogP | 1.03 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.16 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |