C7H8O2 — CID 90476366
2,3,4,5-tetradeuterio-6-methoxyphenol (PubChem CID 90476366) has the molecular formula C7H8O2 and a molecular weight of 128.16 g/mol. Its IUPAC name is 2,3,4,5-tetradeuterio-6-methoxyphenol.
| Compound Name | 2,3,4,5-tetradeuterio-6-methoxyphenol |
|---|---|
| PubChem CID | 90476366 |
| Molecular Formula | C7H8O2 |
| Molecular Weight | 128.16 g/mol |
| Exact Mass | 128.08 |
| IUPAC Name | 2,3,4,5-tetradeuterio-6-methoxyphenol |
| SMILES | [2H]c1c([2H])c([2H])c(OC)c(O)c1[2H] |
| InChI | InChI=1S/C7H8O2/c1-9-7-5-3-2-4-6(7)8/h2-5,8H,1H3/i2D,3D,4D,5D |
| InChIKey | LHGVFZTZFXWLCP-QFFDRWTDSA-N |
| XLogP | 1.40 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.16 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |