C23H23NO3S — CID 51041858
methyl 2-[2-[5-(4-phenylphenyl)pentanoyl]-1,3-thiazol-4-yl]acetate (PubChem CID 51041858) has the molecular formula C23H23NO3S and a molecular weight of 393.51 g/mol. Its IUPAC name is methyl 2-[2-[5-(4-phenylphenyl)pentanoyl]-1,3-thiazol-4-yl]acetate.
| Compound Name | methyl 2-[2-[5-(4-phenylphenyl)pentanoyl]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 51041858 |
| Molecular Formula | C23H23NO3S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | methyl 2-[2-[5-(4-phenylphenyl)pentanoyl]-1,3-thiazol-4-yl]acetate |
| SMILES | COC(=O)Cc1csc(C(=O)CCCCc2ccc(-c3ccccc3)cc2)n1 |
| InChI | InChI=1S/C23H23NO3S/c1-27-22(26)15-20-16-28-23(24-20)21(25)10-6-5-7-17-11-13-19(14-12-17)18-8-3-2-4-9-18/h2-4,8-9,11-14,16H,5-7,10,15H2,1H3 |
| InChIKey | GVDWKAYDNIKONQ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|