C22H21NO3S — CID 118604051
2-[2-[5-(4-phenylphenyl)pentanoyl]-1,3-thiazol-4-yl]acetic acid (PubChem CID 118604051) has the molecular formula C22H21NO3S and a molecular weight of 379.48 g/mol. Its IUPAC name is 2-[2-[5-(4-phenylphenyl)pentanoyl]-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-[5-(4-phenylphenyl)pentanoyl]-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 118604051 |
| Molecular Formula | C22H21NO3S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 2-[2-[5-(4-phenylphenyl)pentanoyl]-1,3-thiazol-4-yl]acetic acid |
| SMILES | O=C(O)Cc1csc(C(=O)CCCCc2ccc(-c3ccccc3)cc2)n1 |
| InChI | InChI=1S/C22H21NO3S/c24-20(22-23-19(15-27-22)14-21(25)26)9-5-4-6-16-10-12-18(13-11-16)17-7-2-1-3-8-17/h1-3,7-8,10-13,15H,4-6,9,14H2,(H,25,26) |
| InChIKey | WOVPODKVLSGKMF-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|