C21H19NO3S — CID 51041859
2-[5-(4-phenylphenyl)pentanoyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 51041859) has the molecular formula C21H19NO3S and a molecular weight of 365.45 g/mol. Its IUPAC name is 2-[5-(4-phenylphenyl)pentanoyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[5-(4-phenylphenyl)pentanoyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 51041859 |
| Molecular Formula | C21H19NO3S |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 2-[5-(4-phenylphenyl)pentanoyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1csc(C(=O)CCCCc2ccc(-c3ccccc3)cc2)n1 |
| InChI | InChI=1S/C21H19NO3S/c23-19(20-22-18(14-26-20)21(24)25)9-5-4-6-15-10-12-17(13-11-15)16-7-2-1-3-8-16/h1-3,7-8,10-14H,4-6,9H2,(H,24,25) |
| InChIKey | IHRLCNBSCIRRMD-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|