C21H29N3O3 — CID 51047336
N-[2-(diethylamino)ethyl]-4-[(2-hydroxy-3-methoxyphenyl)methylamino]benzamide (PubChem CID 51047336) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-4-[(2-hydroxy-3-methoxyphenyl)methylamino]benzamide.
| Compound Name | N-[2-(diethylamino)ethyl]-4-[(2-hydroxy-3-methoxyphenyl)methylamino]benzamide |
|---|---|
| PubChem CID | 51047336 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-4-[(2-hydroxy-3-methoxyphenyl)methylamino]benzamide |
| SMILES | CCN(CC)CCNC(=O)c1ccc(NCc2cccc(OC)c2O)cc1 |
| InChI | InChI=1S/C21H29N3O3/c1-4-24(5-2)14-13-22-21(26)16-9-11-18(12-10-16)23-15-17-7-6-8-19(27-3)20(17)25/h6-12,23,25H,4-5,13-15H2,1-3H3,(H,22,26) |
| InChIKey | ZXZQRFLMYBCITH-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|