C18H16ClFN4O2 — CID 51054141
[1-(2-chloro-5-fluorophenyl)-5-pyrrol-1-ylpyrazol-4-yl]-morpholin-4-ylmethanone (PubChem CID 51054141) has the molecular formula C18H16ClFN4O2 and a molecular weight of 374.80 g/mol. Its IUPAC name is [1-(2-chloro-5-fluorophenyl)-5-pyrrol-1-ylpyrazol-4-yl]-morpholin-4-ylmethanone.
| Compound Name | [1-(2-chloro-5-fluorophenyl)-5-pyrrol-1-ylpyrazol-4-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 51054141 |
| Molecular Formula | C18H16ClFN4O2 |
| Molecular Weight | 374.80 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | [1-(2-chloro-5-fluorophenyl)-5-pyrrol-1-ylpyrazol-4-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(c1cnn(-c2cc(F)ccc2Cl)c1-n1cccc1)N1CCOCC1 |
| InChI | InChI=1S/C18H16ClFN4O2/c19-15-4-3-13(20)11-16(15)24-17(22-5-1-2-6-22)14(12-21-24)18(25)23-7-9-26-10-8-23/h1-6,11-12H,7-10H2 |
| InChIKey | IKEORTDUIQYYLZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 52.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.80 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |