C12H16N2O6S — CID 51091345
methyl 1-(furan-3-carbonylsulfamoyl)piperidine-4-carboxylate (PubChem CID 51091345) has the molecular formula C12H16N2O6S and a molecular weight of 316.33 g/mol. Its IUPAC name is methyl 1-(furan-3-carbonylsulfamoyl)piperidine-4-carboxylate.
| Compound Name | methyl 1-(furan-3-carbonylsulfamoyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 51091345 |
| Molecular Formula | C12H16N2O6S |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | methyl 1-(furan-3-carbonylsulfamoyl)piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(S(=O)(=O)NC(=O)c2ccoc2)CC1 |
| InChI | InChI=1S/C12H16N2O6S/c1-19-12(16)9-2-5-14(6-3-9)21(17,18)13-11(15)10-4-7-20-8-10/h4,7-9H,2-3,5-6H2,1H3,(H,13,15) |
| InChIKey | QDPMLPBBALIFNM-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |