C13H19N3O4S — CID 43605594
methyl 1-[(2-aminophenyl)sulfamoyl]piperidine-4-carboxylate (PubChem CID 43605594) has the molecular formula C13H19N3O4S and a molecular weight of 313.38 g/mol. Its IUPAC name is methyl 1-[(2-aminophenyl)sulfamoyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[(2-aminophenyl)sulfamoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 43605594 |
| Molecular Formula | C13H19N3O4S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | methyl 1-[(2-aminophenyl)sulfamoyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(S(=O)(=O)Nc2ccccc2N)CC1 |
| InChI | InChI=1S/C13H19N3O4S/c1-20-13(17)10-6-8-16(9-7-10)21(18,19)15-12-5-3-2-4-11(12)14/h2-5,10,15H,6-9,14H2,1H3 |
| InChIKey | HZKNBUHJBZAHFT-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|