C11H15ClN4O4S — CID 107596042
methyl 1-[(5-chloropyrazin-2-yl)sulfamoyl]piperidine-4-carboxylate (PubChem CID 107596042) has the molecular formula C11H15ClN4O4S and a molecular weight of 334.79 g/mol. Its IUPAC name is methyl 1-[(5-chloropyrazin-2-yl)sulfamoyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[(5-chloropyrazin-2-yl)sulfamoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 107596042 |
| Molecular Formula | C11H15ClN4O4S |
| Molecular Weight | 334.79 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | methyl 1-[(5-chloropyrazin-2-yl)sulfamoyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(S(=O)(=O)Nc2cnc(Cl)cn2)CC1 |
| InChI | InChI=1S/C11H15ClN4O4S/c1-20-11(17)8-2-4-16(5-3-8)21(18,19)15-10-7-13-9(12)6-14-10/h6-8H,2-5H2,1H3,(H,14,15) |
| InChIKey | UAOFMWRBNJJETC-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.79 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |