C19H23N3O3S — CID 51117326
N-(1,1-dioxothiolan-3-yl)-2-[2-(N-methylanilino)anilino]acetamide (PubChem CID 51117326) has the molecular formula C19H23N3O3S and a molecular weight of 373.48 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-[2-(N-methylanilino)anilino]acetamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-[2-(N-methylanilino)anilino]acetamide |
|---|---|
| PubChem CID | 51117326 |
| Molecular Formula | C19H23N3O3S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-[2-(N-methylanilino)anilino]acetamide |
| SMILES | CN(c1ccccc1)c1ccccc1NCC(=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H23N3O3S/c1-22(16-7-3-2-4-8-16)18-10-6-5-9-17(18)20-13-19(23)21-15-11-12-26(24,25)14-15/h2-10,15,20H,11-14H2,1H3,(H,21,23) |
| InChIKey | FZSCLBKNWHGQRS-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |