C14H13F3N2O5S — CID 51125449
N-[2-[[2-(trifluoromethoxy)phenyl]sulfonylamino]ethyl]furan-3-carboxamide (PubChem CID 51125449) has the molecular formula C14H13F3N2O5S and a molecular weight of 378.33 g/mol. Its IUPAC name is N-[2-[[2-(trifluoromethoxy)phenyl]sulfonylamino]ethyl]furan-3-carboxamide.
| Compound Name | N-[2-[[2-(trifluoromethoxy)phenyl]sulfonylamino]ethyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 51125449 |
| Molecular Formula | C14H13F3N2O5S |
| Molecular Weight | 378.33 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | N-[2-[[2-(trifluoromethoxy)phenyl]sulfonylamino]ethyl]furan-3-carboxamide |
| SMILES | O=C(NCCNS(=O)(=O)c1ccccc1OC(F)(F)F)c1ccoc1 |
| InChI | InChI=1S/C14H13F3N2O5S/c15-14(16,17)24-11-3-1-2-4-12(11)25(21,22)19-7-6-18-13(20)10-5-8-23-9-10/h1-5,8-9,19H,6-7H2,(H,18,20) |
| InChIKey | QCZVVDKYYTZBFP-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.33 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|