C13H11F3N2O4S — CID 47071888
N-[2-[(2,3,4-trifluorophenyl)sulfonylamino]ethyl]furan-3-carboxamide (PubChem CID 47071888) has the molecular formula C13H11F3N2O4S and a molecular weight of 348.30 g/mol. Its IUPAC name is N-[2-[(2,3,4-trifluorophenyl)sulfonylamino]ethyl]furan-3-carboxamide.
| Compound Name | N-[2-[(2,3,4-trifluorophenyl)sulfonylamino]ethyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 47071888 |
| Molecular Formula | C13H11F3N2O4S |
| Molecular Weight | 348.30 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | N-[2-[(2,3,4-trifluorophenyl)sulfonylamino]ethyl]furan-3-carboxamide |
| SMILES | O=C(NCCNS(=O)(=O)c1ccc(F)c(F)c1F)c1ccoc1 |
| InChI | InChI=1S/C13H11F3N2O4S/c14-9-1-2-10(12(16)11(9)15)23(20,21)18-5-4-17-13(19)8-3-6-22-7-8/h1-3,6-7,18H,4-5H2,(H,17,19) |
| InChIKey | OAUSDJSDFXIYKI-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.30 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|