C16H15ClN4O2 — CID 51129185
1-(1H-pyrazol-5-yl)ethyl 5-chloro-3-methyl-1-phenylpyrazole-4-carboxylate (PubChem CID 51129185) has the molecular formula C16H15ClN4O2 and a molecular weight of 330.78 g/mol. Its IUPAC name is 1-(1H-pyrazol-5-yl)ethyl 5-chloro-3-methyl-1-phenylpyrazole-4-carboxylate.
| Compound Name | 1-(1H-pyrazol-5-yl)ethyl 5-chloro-3-methyl-1-phenylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 51129185 |
| Molecular Formula | C16H15ClN4O2 |
| Molecular Weight | 330.78 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 1-(1H-pyrazol-5-yl)ethyl 5-chloro-3-methyl-1-phenylpyrazole-4-carboxylate |
| SMILES | Cc1nn(-c2ccccc2)c(Cl)c1C(=O)OC(C)c1ccn[nH]1 |
| InChI | InChI=1S/C16H15ClN4O2/c1-10-14(16(22)23-11(2)13-8-9-18-19-13)15(17)21(20-10)12-6-4-3-5-7-12/h3-9,11H,1-2H3,(H,18,19) |
| InChIKey | QYBXBDQCAMCYBE-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.78 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |