About 3-[2-(3-chlorophenoxy)ethyl]-2,2-dioxo-1H-2λ6,3-benzothiazin-4-one
3-[2-(3-chlorophenoxy)ethyl]-2,2-dioxo-1H-2λ6,3-benzothiazin-4-one (PubChem CID 51129486) has the molecular formula C16H14ClNO4S
and a molecular weight of 351.81 g/mol. Its IUPAC name is 3-[2-(3-chlorophenoxy)ethyl]-2,2-dioxo-1H-2λ6,3-benzothiazin-4-one.
Molecular Properties
| Compound Name | 3-[2-(3-chlorophenoxy)ethyl]-2,2-dioxo-1H-2λ6,3-benzothiazin-4-one |
| PubChem CID | 51129486 |
| Molecular Formula | C16H14ClNO4S |
| Molecular Weight | 351.81 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | 3-[2-(3-chlorophenoxy)ethyl]-2,2-dioxo-1H-2λ6,3-benzothiazin-4-one |
| SMILES | O=C1c2ccccc2CS(=O)(=O)N1CCOc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H14ClNO4S/c17-13-5-3-6-14(10-13)22-9-8-18-16(19)15-7-2-1-4-12(15)11-23(18,20)21/h1-7,10H,8-9,11H2 |
| InChIKey | MUDAAWKPRKBHLO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.81 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[2-(3-chlorophenoxy)ethyl]-2,2-dioxo-1H-2λ6,3-benzothiazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(3-chlorophenoxy)ethyl]-2,2-dioxo-1H-2λ6,3-benzothiazin-4-one?
The IUPAC name of 3-[2-(3-chlorophenoxy)ethyl]-2,2-dioxo-1H-2λ6,3-benzothiazin-4-one (CID 51129486) is 3-[2-(3-chlorophenoxy)ethyl]-2,2-dioxo-1H-2λ6,3-benzothiazin-4-one.
What is the SMILES notation for 3-[2-(3-chlorophenoxy)ethyl]-2,2-dioxo-1H-2λ6,3-benzothiazin-4-one?
The canonical SMILES for 3-[2-(3-chlorophenoxy)ethyl]-2,2-dioxo-1H-2λ6,3-benzothiazin-4-one is O=C1c2ccccc2CS(=O)(=O)N1CCOc1cccc(Cl)c1.
What is the InChIKey of 3-[2-(3-chlorophenoxy)ethyl]-2,2-dioxo-1H-2λ6,3-benzothiazin-4-one?
The InChIKey is MUDAAWKPRKBHLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14ClNO4S/c17-13-5-3-6-14(10-13)22-9-8-18-16(19)15-7-2-1-4-12(15)11-23(18,20)21/h1-7,10H,8-9,11H2.
What are the key properties of 3-[2-(3-chlorophenoxy)ethyl]-2,2-dioxo-1H-2λ6,3-benzothiazin-4-one?
3-[2-(3-chlorophenoxy)ethyl]-2,2-dioxo-1H-2λ6,3-benzothiazin-4-one has a molecular weight of 351.81 g/mol, XLogP of 2.70, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(3-chlorophenoxy)ethyl]-2,2-dioxo-1H-2λ6,3-benzothiazin-4-one is sourced from PubChem (CID 51129486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).