C17H25ClN4O2 — CID 51131404
3-[(1,3-dimethyl-5-phenoxypyrazol-4-yl)methylamino]-N,N-dimethylpropanamide;hydrochloride (PubChem CID 51131404) has the molecular formula C17H25ClN4O2 and a molecular weight of 352.87 g/mol. Its IUPAC name is 3-[(1,3-dimethyl-5-phenoxypyrazol-4-yl)methylamino]-N,N-dimethylpropanamide;hydrochloride.
| Compound Name | 3-[(1,3-dimethyl-5-phenoxypyrazol-4-yl)methylamino]-N,N-dimethylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 51131404 |
| Molecular Formula | C17H25ClN4O2 |
| Molecular Weight | 352.87 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 3-[(1,3-dimethyl-5-phenoxypyrazol-4-yl)methylamino]-N,N-dimethylpropanamide;hydrochloride |
| SMILES | Cc1nn(C)c(Oc2ccccc2)c1CNCCC(=O)N(C)C.Cl |
| InChI | InChI=1S/C17H24N4O2.ClH/c1-13-15(12-18-11-10-16(22)20(2)3)17(21(4)19-13)23-14-8-6-5-7-9-14;/h5-9,18H,10-12H2,1-4H3;1H |
| InChIKey | CONHWBDGZIWSTE-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.87 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|