C23H30N6O2S — CID 51134481
1-(2-cyclopentylsulfanylphenyl)-3-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]urea (PubChem CID 51134481) has the molecular formula C23H30N6O2S and a molecular weight of 454.60 g/mol. Its IUPAC name is 1-(2-cyclopentylsulfanylphenyl)-3-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]urea.
| Compound Name | 1-(2-cyclopentylsulfanylphenyl)-3-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]urea |
|---|---|
| PubChem CID | 51134481 |
| Molecular Formula | C23H30N6O2S |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | 1-(2-cyclopentylsulfanylphenyl)-3-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]urea |
| SMILES | O=C(NCCC(=O)N1CCN(c2ncccn2)CC1)Nc1ccccc1SC1CCCC1 |
| InChI | InChI=1S/C23H30N6O2S/c30-21(28-14-16-29(17-15-28)22-24-11-5-12-25-22)10-13-26-23(31)27-19-8-3-4-9-20(19)32-18-6-1-2-7-18/h3-5,8-9,11-12,18H,1-2,6-7,10,13-17H2,(H2,26,27,31) |
| InChIKey | POHUQPREEJCVLT-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |