C18H18N2O2 — CID 51332477
4-acetyl-3,5-dimethyl-N-(3-phenylprop-2-ynyl)-1H-pyrrole-2-carboxamide (PubChem CID 51332477) has the molecular formula C18H18N2O2 and a molecular weight of 294.35 g/mol. Its IUPAC name is 4-acetyl-3,5-dimethyl-N-(3-phenylprop-2-ynyl)-1H-pyrrole-2-carboxamide.
| Compound Name | 4-acetyl-3,5-dimethyl-N-(3-phenylprop-2-ynyl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 51332477 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 4-acetyl-3,5-dimethyl-N-(3-phenylprop-2-ynyl)-1H-pyrrole-2-carboxamide |
| SMILES | CC(=O)c1c(C)[nH]c(C(=O)NCC#Cc2ccccc2)c1C |
| InChI | InChI=1S/C18H18N2O2/c1-12-16(14(3)21)13(2)20-17(12)18(22)19-11-7-10-15-8-5-4-6-9-15/h4-6,8-9,20H,11H2,1-3H3,(H,19,22) |
| InChIKey | KZZWRBYTJSTOQN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|