C20H15N2NaO5S — CID 5133466
sodium 6-amino-2-(2,4-dimethylphenyl)-1,3-dioxobenzo[de]isoquinoline-5-sulfonate (PubChem CID 5133466) has the molecular formula C20H15N2NaO5S and a molecular weight of 418.41 g/mol. Its IUPAC name is sodium 6-amino-2-(2,4-dimethylphenyl)-1,3-dioxobenzo[de]isoquinoline-5-sulfonate.
| Compound Name | sodium 6-amino-2-(2,4-dimethylphenyl)-1,3-dioxobenzo[de]isoquinoline-5-sulfonate |
|---|---|
| PubChem CID | 5133466 |
| Molecular Formula | C20H15N2NaO5S |
| Molecular Weight | 418.41 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | sodium 6-amino-2-(2,4-dimethylphenyl)-1,3-dioxobenzo[de]isoquinoline-5-sulfonate |
| SMILES | Cc1ccc(N2C(=O)c3cccc4c(N)c(S(=O)(=O)[O-])cc(c34)C2=O)c(C)c1.[Na+] |
| InChI | InChI=1S/C20H16N2O5S.Na/c1-10-6-7-15(11(2)8-10)22-19(23)13-5-3-4-12-17(13)14(20(22)24)9-16(18(12)21)28(25,26)27;/h3-9H,21H2,1-2H3,(H,25,26,27);/q;+1/p-1 |
| InChIKey | MOMZIYOVXUPURU-UHFFFAOYSA-M |
| XLogP | -0.25 |
| TPSA | 120.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.41 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|