C29H32FN3O6S — CID 51355423
N-[(E)-4-[4-[2-(2-fluoroethoxy)phenyl]piperazin-1-yl]but-2-enyl]-4-thiophen-3-ylbenzamide;oxalic acid (PubChem CID 51355423) has the molecular formula C29H32FN3O6S and a molecular weight of 569.66 g/mol. Its IUPAC name is N-[(E)-4-[4-[2-(2-fluoroethoxy)phenyl]piperazin-1-yl]but-2-enyl]-4-thiophen-3-ylbenzamide;oxalic acid.
| Compound Name | N-[(E)-4-[4-[2-(2-fluoroethoxy)phenyl]piperazin-1-yl]but-2-enyl]-4-thiophen-3-ylbenzamide;oxalic acid |
|---|---|
| PubChem CID | 51355423 |
| Molecular Formula | C29H32FN3O6S |
| Molecular Weight | 569.66 g/mol |
| Exact Mass | 569.20 |
| IUPAC Name | N-[(E)-4-[4-[2-(2-fluoroethoxy)phenyl]piperazin-1-yl]but-2-enyl]-4-thiophen-3-ylbenzamide;oxalic acid |
| SMILES | O=C(NC/C=C/CN1CCN(c2ccccc2OCCF)CC1)c1ccc(-c2ccsc2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C27H30FN3O2S.C2H2O4/c28-12-19-33-26-6-2-1-5-25(26)31-17-15-30(16-18-31)14-4-3-13-29-27(32)23-9-7-22(8-10-23)24-11-20-34-21-24;3-1(4)2(5)6/h1-11,20-21H,12-19H2,(H,29,32);(H,3,4)(H,5,6)/b4-3+; |
| InChIKey | RYGVCNZOLPYZLZ-BJILWQEISA-N |
| XLogP | 4.03 |
| TPSA | 119.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.66 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|