C8H16FNO2 — CID 51357589
(3R,4R,5S)-5-[(1S)-1-fluoropropyl]piperidine-3,4-diol (PubChem CID 51357589) has the molecular formula C8H16FNO2 and a molecular weight of 177.22 g/mol. Its IUPAC name is (3R,4R,5S)-5-[(1S)-1-fluoropropyl]piperidine-3,4-diol.
| Compound Name | (3R,4R,5S)-5-[(1S)-1-fluoropropyl]piperidine-3,4-diol |
|---|---|
| PubChem CID | 51357589 |
| Molecular Formula | C8H16FNO2 |
| Molecular Weight | 177.22 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | (3R,4R,5S)-5-[(1S)-1-fluoropropyl]piperidine-3,4-diol |
| SMILES | CC[C@H](F)[C@H]1CNC[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C8H16FNO2/c1-2-6(9)5-3-10-4-7(11)8(5)12/h5-8,10-12H,2-4H2,1H3/t5-,6+,7-,8-/m1/s1 |
| InChIKey | JJOAXUOFRVBCHL-ULAWRXDQSA-N |
| XLogP | -0.32 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.22 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |