C23H27ClFN3O — CID 51362459
N-[(2-chloro-6-fluorophenyl)methyl]-5-(4-ethoxyphenyl)-1-(2-methylbutyl)imidazol-2-amine (PubChem CID 51362459) has the molecular formula C23H27ClFN3O and a molecular weight of 415.94 g/mol. Its IUPAC name is N-[(2-chloro-6-fluorophenyl)methyl]-5-(4-ethoxyphenyl)-1-(2-methylbutyl)imidazol-2-amine.
| Compound Name | N-[(2-chloro-6-fluorophenyl)methyl]-5-(4-ethoxyphenyl)-1-(2-methylbutyl)imidazol-2-amine |
|---|---|
| PubChem CID | 51362459 |
| Molecular Formula | C23H27ClFN3O |
| Molecular Weight | 415.94 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | N-[(2-chloro-6-fluorophenyl)methyl]-5-(4-ethoxyphenyl)-1-(2-methylbutyl)imidazol-2-amine |
| SMILES | CCOc1ccc(-c2cnc(NCc3c(F)cccc3Cl)n2CC(C)CC)cc1 |
| InChI | InChI=1S/C23H27ClFN3O/c1-4-16(3)15-28-22(17-9-11-18(12-10-17)29-5-2)14-27-23(28)26-13-19-20(24)7-6-8-21(19)25/h6-12,14,16H,4-5,13,15H2,1-3H3,(H,26,27) |
| InChIKey | KMWKEWVYZSXGBS-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.94 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |