C19H17ClN4O2S — CID 51365202
N-(2-chloro-3-pyridinyl)-2-[2-(4-methoxyphenyl)-6-methylpyrimidin-4-yl]sulfanylacetamide (PubChem CID 51365202) has the molecular formula C19H17ClN4O2S and a molecular weight of 400.89 g/mol. Its IUPAC name is N-(2-chloro-3-pyridinyl)-2-[2-(4-methoxyphenyl)-6-methylpyrimidin-4-yl]sulfanylacetamide.
| Compound Name | N-(2-chloro-3-pyridinyl)-2-[2-(4-methoxyphenyl)-6-methylpyrimidin-4-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 51365202 |
| Molecular Formula | C19H17ClN4O2S |
| Molecular Weight | 400.89 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | N-(2-chloro-3-pyridinyl)-2-[2-(4-methoxyphenyl)-6-methylpyrimidin-4-yl]sulfanylacetamide |
| SMILES | COc1ccc(-c2nc(C)cc(SCC(=O)Nc3cccnc3Cl)n2)cc1 |
| InChI | InChI=1S/C19H17ClN4O2S/c1-12-10-17(24-19(22-12)13-5-7-14(26-2)8-6-13)27-11-16(25)23-15-4-3-9-21-18(15)20/h3-10H,11H2,1-2H3,(H,23,25) |
| InChIKey | DSPGDUBGJZEVMQ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.89 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|