C17H25N5O2 — CID 51369274
N-butyl-2-(3-pyridin-2-yl-1-oxa-2,4,8-triazaspiro[4.5]dec-3-en-8-yl)acetamide (PubChem CID 51369274) has the molecular formula C17H25N5O2 and a molecular weight of 331.42 g/mol. Its IUPAC name is N-butyl-2-(3-pyridin-2-yl-1-oxa-2,4,8-triazaspiro[4.5]dec-3-en-8-yl)acetamide.
| Compound Name | N-butyl-2-(3-pyridin-2-yl-1-oxa-2,4,8-triazaspiro[4.5]dec-3-en-8-yl)acetamide |
|---|---|
| PubChem CID | 51369274 |
| Molecular Formula | C17H25N5O2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | N-butyl-2-(3-pyridin-2-yl-1-oxa-2,4,8-triazaspiro[4.5]dec-3-en-8-yl)acetamide |
| SMILES | CCCCNC(=O)CN1CCC2(CC1)N=C(c1ccccn1)NO2 |
| InChI | InChI=1S/C17H25N5O2/c1-2-3-9-19-15(23)13-22-11-7-17(8-12-22)20-16(21-24-17)14-6-4-5-10-18-14/h4-6,10H,2-3,7-9,11-13H2,1H3,(H,19,23)(H,20,21) |
| InChIKey | YMVXGLMWMOEOPT-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|